Clanfenur structure
|
Common Name | Clanfenur | ||
|---|---|---|---|---|
| CAS Number | 51213-99-1 | Molecular Weight | 335.76 | |
| Density | 1.371g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H15ClFN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ClanfenurClanfenur is a substituted benzoylphenylurea, an analogue of the pesticide fenfluramide, with potential antineoplastic activity. Clanfenur can bind to the colchicine-binding site on β-tubulin, inhibit microtubule polymerization, and thus prevent tumor cell replication[1]. |
| Name | Clanfenur |
|---|---|
| Synonym | More Synonyms |
| Description | Clanfenur is a substituted benzoylphenylurea, an analogue of the pesticide fenfluramide, with potential antineoplastic activity. Clanfenur can bind to the colchicine-binding site on β-tubulin, inhibit microtubule polymerization, and thus prevent tumor cell replication[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.371g/cm3 |
|---|---|
| Molecular Formula | C16H15ClFN3O2 |
| Molecular Weight | 335.76 |
| Exact Mass | 335.08400 |
| PSA | 61.44000 |
| LogP | 3.97090 |
| Index of Refraction | 1.64 |
| InChIKey | SRLPZQAEBMZCIJ-UHFFFAOYSA-N |
| SMILES | CN(C)c1cccc(F)c1C(=O)NC(=O)Nc1ccc(Cl)cc1 |
| Storage condition | -20℃ |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-(2-Dimethylaminoethyl)-piperazine |
| dimethyl(2-piperazinylethyl)amine |
| 1-(2-N,N-dimethylamino-6-fluorobenzoyl)-3-(4-chlorophenyl)urea |
| N,N-Dimethyl-2-(piperazin-1-yl)ethanamine |
| N-(CH2)2NMe2-piperazine |
| 4-(2-dimethylaminoethyl)piperazine |
| dimethyl(2-piperazin-1-yl-ethyl)amine |
| N-[[(4-chlorophenyl)amino]carbonyl]-2-(dimethylamino)-6-fluorobenzamide |
| 1-(2-N,N-dimethyl)-ethylpiperazine |