2-(4-hydroxy-3-nitrophenyl)butyronitrile structure
|
Common Name | 2-(4-hydroxy-3-nitrophenyl)butyronitrile | ||
|---|---|---|---|---|
| CAS Number | 51234-22-1 | Molecular Weight | 206.19800 | |
| Density | 1.291g/cm3 | Boiling Point | 329.1ºC at 760mmHg | |
| Molecular Formula | C10H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.8ºC | |
| Name | 2-(4-hydroxy-3-nitrophenyl)butanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.291g/cm3 |
|---|---|
| Boiling Point | 329.1ºC at 760mmHg |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.19800 |
| Flash Point | 152.8ºC |
| Exact Mass | 206.06900 |
| PSA | 89.84000 |
| LogP | 2.84078 |
| Index of Refraction | 1.583 |
| InChIKey | GGVUDMNCNFJLTF-UHFFFAOYSA-N |
| SMILES | CCC(C#N)c1ccc(O)c([N+](=O)[O-])c1 |
|
~%
2-(4-hydroxy-3-... CAS#:51234-22-1 |
| Literature: Dunwell,D.W. et al. Journal of Medicinal Chemistry, 1975 , vol. 18, # 1 p. 53 - 58 |
|
~%
2-(4-hydroxy-3-... CAS#:51234-22-1 |
| Literature: Dunwell,D.W. et al. Journal of Medicinal Chemistry, 1975 , vol. 18, # 1 p. 53 - 58 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| 4-Hydroxy-3-nitrophenyl-a-methylacetonitrile |
| Benzeneacetonitrile,4-hydroxy-a-methyl-3-nitro |
| EINECS 257-068-1 |