Methyl 2-(4-hydroxy-3-nitrophenyl)acetate structure
|
Common Name | Methyl 2-(4-hydroxy-3-nitrophenyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 61873-93-6 | Molecular Weight | 211.17100 | |
| Density | 1.384±0.06 g/cm3(Predicted) | Boiling Point | 327.6±27.0 °C(Predicted) | |
| Molecular Formula | C9H9NO5 | Melting Point | 65-67ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 2-(4-hydroxy-3-nitrophenyl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.384±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 327.6±27.0 °C(Predicted) |
| Melting Point | 65-67ºC |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17100 |
| Exact Mass | 211.04800 |
| PSA | 92.35000 |
| LogP | 1.53910 |
| InChIKey | SPCRIUSIYZYZKN-UHFFFAOYSA-N |
| SMILES | COC(=O)Cc1ccc(O)c([N+](=O)[O-])c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918290000 |
|
~97%
Methyl 2-(4-hyd... CAS#:61873-93-6 |
| Literature: OXFORD GLYCOSCIENCES (UK) LTD Patent: WO2004/46122 A2, 2004 ; Location in patent: Page 15 ; |
|
~%
Methyl 2-(4-hyd... CAS#:61873-93-6 |
| Literature: US6358992 B1, ; |
|
~99%
Methyl 2-(4-hyd... CAS#:61873-93-6 |
| Literature: DAIICHI PHARMACEUTICAL CO., LTD. Patent: EP1346982 A1, 2003 ; |
|
~%
Methyl 2-(4-hyd... CAS#:61873-93-6 |
| Literature: DR.REDDY'S LABORATORIES LTD.; SASMAL, Pradip Kumar; VAMSEEKRISHNA, Chintakunta; POTLURI, Vijay; TEHIM, Ashok; GAI, Yonghua; ZHANG, Hang Patent: WO2013/131408 A1, 2013 ; Location in patent: Page/Page column 64 ; |
|
~%
Methyl 2-(4-hyd... CAS#:61873-93-6 |
| Literature: WO2013/131408 A1, ; |
|
~%
Methyl 2-(4-hyd... CAS#:61873-93-6 |
| Literature: WO2013/131408 A1, ; |
|
~%
Methyl 2-(4-hyd... CAS#:61873-93-6 |
| Literature: WO2013/19682 A1, ; WO 2013/019682 A1 |
|
~%
Methyl 2-(4-hyd... CAS#:61873-93-6 |
| Literature: Chemistry of Natural Compounds, , vol. 26, # 6 p. 691 - 696 Khimiya Prirodnykh Soedinenii, , # 6 p. 811 - 818 |
| Precursor 9 | |
|---|---|
| DownStream 5 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| Methyl (4-hydroxy-3-nitrophenyl)acetate |
| 3-nitro-4-hydroxyphenylacetic acid methyl ester |
| methylhydroxynitrophenylacetate |
| methyl-2-(4-hydroxy-3-nitrophenyl)acetate |
| methyl 3-nitro-4-hydroxyphenylacetate |