5,7-diacetoxy-3,4',8-trimethoxyflavone structure
|
Common Name | 5,7-diacetoxy-3,4',8-trimethoxyflavone | ||
|---|---|---|---|---|
| CAS Number | 5128-43-8 | Molecular Weight | 428.389 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 599.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H20O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.3±30.2 °C | |
| Name | 3,8-Dimethoxy-2-(4-methoxyphenyl)-4-oxo-4H-chromene-5,7-diyl diac etate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 599.1±50.0 °C at 760 mmHg |
| Molecular Formula | C22H20O9 |
| Molecular Weight | 428.389 |
| Flash Point | 260.3±30.2 °C |
| Exact Mass | 428.110718 |
| PSA | 110.50000 |
| LogP | 0.93 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | PKVJLPXCFDHGEY-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2oc3c(OC)c(OC(C)=O)cc(OC(C)=O)c3c(=O)c2OC)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2915390090 |
|
~%
5,7-diacetoxy-3... CAS#:5128-43-8 |
| Literature: Balakrishna; Seshadri Proceedings - Indian Academy of Sciences, Section A, 1947 , # 26 p. 214,218 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 4H-1-Benzopyran-4-one, 5,7-bis(acetyloxy)-3,8-dimethoxy-2-(4-methoxyphenyl)- |
| 5,7-dihydroxy-3,4',8-trimethoxyflavone diacetate |
| 5,7-Diacetoxy-3,8,4'-trimethoxy-flavon |
| 5,7-diacetoxy-3-pyridin-3-yl-chromen-2-one |
| 3,8-Dimethoxy-2-(4-methoxyphenyl)-4-oxo-4H-chromene-5,7-diyl diacetate |
| 3-O-Methyl-prudomestin-diacetat |