3-(3,5-ditert-butyl-4-hydroxyphenyl)propanenitrile structure
|
Common Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanenitrile | ||
|---|---|---|---|---|
| CAS Number | 5128-83-6 | Molecular Weight | 259.38600 | |
| Density | 0.982g/cm3 | Boiling Point | 355ºC at 760 mmHg | |
| Molecular Formula | C17H25NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.5ºC | |
| Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 0.982g/cm3 |
|---|---|
| Boiling Point | 355ºC at 760 mmHg |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.38600 |
| Flash Point | 168.5ºC |
| Exact Mass | 259.19400 |
| PSA | 44.02000 |
| LogP | 4.44338 |
| Index of Refraction | 1.51 |
| InChIKey | GFYMECOPFJQEAI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(CCC#N)cc(C(C)(C)C)c1O |
| HS Code | 2917190090 |
|---|
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| hms1613o15 |