N-[3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)phenyl]acetamide structure
|
Common Name | N-[3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 51318-81-1 | Molecular Weight | 377.38800 | |
| Density | 1.205g/cm3 | Boiling Point | 528.6ºC at 760 mmHg | |
| Molecular Formula | C19H23NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.5ºC | |
| Name | N-[3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)phenyl]acetamide |
|---|
| Density | 1.205g/cm3 |
|---|---|
| Boiling Point | 528.6ºC at 760 mmHg |
| Molecular Formula | C19H23NO7 |
| Molecular Weight | 377.38800 |
| Flash Point | 273.5ºC |
| Exact Mass | 377.14700 |
| PSA | 84.48000 |
| LogP | 3.55330 |
| Index of Refraction | 1.554 |
| InChIKey | NKNXUZZXZGMPSO-UHFFFAOYSA-N |
| SMILES | COc1cc(Oc2c(OC)cc(NC(C)=O)cc2OC)cc(OC)c1OC |
| HS Code | 2924299090 |
|---|
|
~%
N-[3,5-dimethox... CAS#:51318-81-1 |
| Literature: Sattler; Glombitza Archiv der Pharmazie, 1975 , vol. 308, # 11 p. 813 - 818 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |