3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)aniline
3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)aniline structure
|
Common Name | 3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)aniline | ||
|---|---|---|---|---|
| CAS Number | 51318-82-2 | Molecular Weight | 335.35200 | |
| Density | 1.187g/cm3 | Boiling Point | 472.3ºC at 760 mmHg | |
| Molecular Formula | C17H21NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.2ºC | |
Summary: 3,5-Dimethoxy-4-(3,4,5-trimethoxyphenoxy)aniline, Chinese name not provided, CAS number 51318-82-2, molecular formula C17H21NO6, molecular weight 335.35200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)aniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.187g/cm3 |
|---|---|
| Boiling Point | 472.3ºC at 760 mmHg |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.35200 |
| Flash Point | 251.2ºC |
| Exact Mass | 335.13700 |
| PSA | 81.40000 |
| LogP | 3.68530 |
| Index of Refraction | 1.552 |
| InChIKey | NIQCJOZZIBCXDF-UHFFFAOYSA-N |
| SMILES | COc1cc(Oc2c(OC)cc(N)cc2OC)cc(OC)c1OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3,5-dimethoxy-4... CAS#:51318-82-2 |
| Literature: Sattler; Glombitza Archiv der Pharmazie, 1975 , vol. 308, # 11 p. 813 - 818 |
|
~%
3,5-dimethoxy-4... CAS#:51318-82-2 |
| Literature: Sattler; Glombitza Archiv der Pharmazie, 1975 , vol. 308, # 11 p. 813 - 818 |
![N-[3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)phenyl]acetamide structure](https://image.chemsrc.com/caspic/364/51318-81-1.png)
![Ethanone,1-[3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)phenyl]-, oxime structure](https://image.chemsrc.com/caspic/402/51318-80-0.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 3 | |
CAS#:58235-54-4
CAS#:51318-83-3![5-[2,6-dimethoxy-4-(2,4,6-trimethoxyphenoxy)phenoxy]-1,2,3-trimethoxy-benzene structure](https://image.chemsrc.com/caspic/250/51318-84-4.png)
CAS#:51318-84-4This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)aniline? |
| A: Polar surface area (PSA) of 3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)aniline is 81.40000. |
| Q: What is the InChIKey of 3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)aniline? |
| A: InChIKey of 3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)aniline is NIQCJOZZIBCXDF-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)aniline? |
| A: Molecular weight of 3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)aniline is 335.35200. |
| Q: What is the molecular formula of 3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)aniline? |
| A: Molecular formula of 3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)aniline is C17H21NO6. |
| Q: What is the SMILES notation of 3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)aniline? |
| A: SMILES notation of 3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)aniline is COc1cc(Oc2c(OC)cc(N)cc2OC)cc(OC)c1OC. |
| Q: What is the CAS number of 3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)aniline? |
| A: CAS number of 3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)aniline is 51318-82-2. |
| Q: What is the English name of 3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)aniline? |
| A: The English name of 3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)aniline is 3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)aniline. |
| Q: What is the LogP of 3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)aniline? |
| A: LogP of 3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)aniline is 3.68530. |
| Q: What is the boiling point of 3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)aniline? |
| A: Boiling point of 3,5-dimethoxy-4-(3,4,5-trimethoxyphenoxy)aniline is 472.3ºC at 760 mmHg. |
| Q: What is the Chinese name of 51318-82-2? |
| A: Chinese name of 51318-82-2 is 51318-82-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |