4,6-Bis(isopropylamino)-2-mercapto-1,3,5-triazine structure
|
Common Name | 4,6-Bis(isopropylamino)-2-mercapto-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 5133-47-1 | Molecular Weight | 227.33000 | |
| Density | 1.27g/cm3 | Boiling Point | 296.3ºC at 760mmHg | |
| Molecular Formula | C9H17N5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133ºC | |
| Name | 2,6-bis(propan-2-ylamino)-1H-1,3,5-triazine-4-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 296.3ºC at 760mmHg |
| Molecular Formula | C9H17N5S |
| Molecular Weight | 227.33000 |
| Flash Point | 133ºC |
| Exact Mass | 227.12000 |
| PSA | 101.53000 |
| LogP | 1.94690 |
| Index of Refraction | 1.631 |
| InChIKey | ZHUKDYCLYXWRAV-UHFFFAOYSA-N |
| SMILES | CC(C)Nc1nc(=S)nc(NC(C)C)[nH]1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 4,6-Bis((1-methylethyl)amino)-1,3,5-triazine-2(1H)-thione |
| 4,6-bis-isopropylamino-1H-[1,3,5]triazine-2-thione |
| 1,3,5-Triazine-2(1H)-thione,4,6-bis[(1-methylethyl)amino] |
| s-Triazine-2-thiol,4,6-bis(isopropylamino)-(7CI,8CI) |
| 4,6-BIS(ISOPROPYLAMINO)-2-MERCAPTO-1,3,5-TRIAZINE |
| 2,4-bis(isopropylamino)-6-mercapto-1,3,5-triazine |
| 2-Mercapto-4,6-bis(isopropylamino)-s-triazine |