N-(3-methyl-4-nitrophenyl)acetamide structure
|
Common Name | N-(3-methyl-4-nitrophenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 51366-39-3 | Molecular Weight | 194.18700 | |
| Density | 1.289g/cm3 | Boiling Point | 391.9ºC at 760 mmHg | |
| Molecular Formula | C9H10N2O3 | Melting Point | 121ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 190.8ºC | |
| Name | N-(3-methyl-4-nitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.289g/cm3 |
|---|---|
| Boiling Point | 391.9ºC at 760 mmHg |
| Melting Point | 121ºC(lit.) |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.18700 |
| Flash Point | 190.8ºC |
| Exact Mass | 194.06900 |
| PSA | 74.92000 |
| LogP | 2.45780 |
| Index of Refraction | 1.605 |
| InChIKey | HTOMFNRBNSBPIU-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc([N+](=O)[O-])c(C)c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| HS Code | 2924299090 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Acetamido-2-methylnitrobenzene |
| MFCD00628976 |
| 3-Methyl-4-nitroacetanilide |