bis(4-methylphenyl)mercury structure
|
Common Name | bis(4-methylphenyl)mercury | ||
|---|---|---|---|---|
| CAS Number | 537-64-4 | Molecular Weight | 382.85100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14Hg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(4-methylphenyl)mercury |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14Hg |
|---|---|
| Molecular Weight | 382.85100 |
| Exact Mass | 384.08000 |
| LogP | 2.33670 |
| InChIKey | DYGWZUBGVKYLJJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc([Hg]c2ccc(C)cc2)cc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| p-Ditolymercury |
| Di-p-tolyl-quecksilber |
| Di-p-tolyl mercury |
| Mercury,di-p-tolyl |