Butanedioic acid,2-sulfo-, 1,4-dibutyl ester, sodium salt (1:1) structure
|
Common Name | Butanedioic acid,2-sulfo-, 1,4-dibutyl ester, sodium salt (1:1) | ||
|---|---|---|---|---|
| CAS Number | 5144-51-4 | Molecular Weight | 333.35400 | |
| Density | 1.229g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H22NaO7S+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,1,4-dibutoxy-1,4-dioxobutane-2-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.229g/cm3 |
|---|---|
| Molecular Formula | C12H22NaO7S+ |
| Molecular Weight | 333.35400 |
| Exact Mass | 333.09800 |
| PSA | 115.35000 |
| LogP | 2.40030 |
| InChIKey | JLABKOUORPVZCA-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)CC(C(=O)OCCCC)S(=O)(=O)O.[Na+] |
|
~88%
Butanedioic aci... CAS#:5144-51-4 |
| Literature: Liu, Zhao-Tie; Liu, Ling; Wu, Jin; Song, Liping; Gao, Ziwei; Dong, Wensheng; Lu, Jian Journal of Chemical and Engineering Data, 2006 , vol. 51, # 6 p. 2045 - 2050 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| Succinic acid,1,4-dibutyl ester,sodium salt |
| Sodium dibutyl sulfosuccinate |
| Sodium sulfosuccinic acid dibutyl ester |
| Butanedioic acid,1,4-dibutyl ester,sodium salt |