6-cyano-7-ethoxy-7-hydroxy-5-oxo-hept-6-enoic acid structure
|
Common Name | 6-cyano-7-ethoxy-7-hydroxy-5-oxo-hept-6-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 51453-81-7 | Molecular Weight | 227.21400 | |
| Density | 1.292g/cm3 | Boiling Point | 482.4ºC at 760 mmHg | |
| Molecular Formula | C10H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.6ºC | |
| Name | (Z)-6-cyano-7-ethoxy-5-hydroxy-7-oxohept-5-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.292g/cm3 |
|---|---|
| Boiling Point | 482.4ºC at 760 mmHg |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.21400 |
| Flash Point | 245.6ºC |
| Exact Mass | 227.07900 |
| PSA | 107.62000 |
| LogP | 1.14008 |
| Index of Refraction | 1.513 |
| InChIKey | SVBCDQVTCQAGAQ-FPLPWBNLSA-N |
| SMILES | CCOC(=O)C(C#N)=C(O)CCCC(=O)O |
|
~%
6-cyano-7-ethox... CAS#:51453-81-7 |
| Literature: Smissman; Wachter; Barfknecht; Gabbard Journal of pharmaceutical sciences, 1973 , vol. 62, # 11 p. 1772 - 1775 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-cyano-7-ethoxy-7-hydroxy-5-oxohept-6-enoic acid |