Ethanimidic acid,2,2,2-trichloro-, 3-phenyl-2-propen-1-yl ester structure
|
Common Name | Ethanimidic acid,2,2,2-trichloro-, 3-phenyl-2-propen-1-yl ester | ||
|---|---|---|---|---|
| CAS Number | 51479-71-1 | Molecular Weight | 278.56200 | |
| Density | 1.27g/cm3 | Boiling Point | 307.8ºC at 760mmHg | |
| Molecular Formula | C11H10Cl3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140ºC | |
| Name | [(E)-3-phenylprop-2-enyl] 2,2,2-trichloroethanimidate |
|---|
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 307.8ºC at 760mmHg |
| Molecular Formula | C11H10Cl3NO |
| Molecular Weight | 278.56200 |
| Flash Point | 140ºC |
| Exact Mass | 276.98300 |
| PSA | 33.08000 |
| LogP | 4.16360 |
| Index of Refraction | 1.54 |
| InChIKey | GLDKSYZZEFAGMD-ZPEYGQBVSA-N |
| SMILES | N=C(OCC=Cc1ccccc1)C(Cl)(Cl)Cl |
|
~%
Ethanimidic aci... CAS#:51479-71-1 |
| Literature: Overman,L.E. Journal of the American Chemical Society, 1976 , vol. 98, p. 2901 - 2910 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |