cyclohex-2-en-1-yl 2,2,2-trichloroethanimidate structure
|
Common Name | cyclohex-2-en-1-yl 2,2,2-trichloroethanimidate | ||
|---|---|---|---|---|
| CAS Number | 51479-76-6 | Molecular Weight | 242.53000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10Cl3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | cyclohex-2-en-1-yl 2,2,2-trichloroethanimidate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H10Cl3NO |
|---|---|
| Molecular Weight | 242.53000 |
| Exact Mass | 240.98300 |
| PSA | 33.08000 |
| LogP | 3.55890 |
| InChIKey | QHKIFWRELFFYID-UHFFFAOYSA-N |
| SMILES | N=C(OC1C=CCCC1)C(Cl)(Cl)Cl |
|
~%
cyclohex-2-en-1... CAS#:51479-76-6 |
| Literature: Overman,L.E. Journal of the American Chemical Society, 1976 , vol. 98, p. 2901 - 2910 |
| Ethanimidic acid,2,2,2-trichloro-,2-cyclohexen-1-yl ester |