6-Bromochromone-2-carboxylic acid
Modify Date: 2025-08-26 11:04:44
6-Bromochromone-2-carboxylic acid structure
|
Common Name | 6-Bromochromone-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 51484-06-1 | Molecular Weight | 269.04800 | |
| Density | 1.874g/cm3 | Boiling Point | 397.8ºC at 760 mmHg | |
| Molecular Formula | C10H5BrO4 | Melting Point | ~265 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 194.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 6-Bromochromone-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.874g/cm3 |
|---|---|
| Boiling Point | 397.8ºC at 760 mmHg |
| Melting Point | ~265 °C (dec.)(lit.) |
| Molecular Formula | C10H5BrO4 |
| Molecular Weight | 269.04800 |
| Flash Point | 194.4ºC |
| Exact Mass | 267.93700 |
| PSA | 67.51000 |
| LogP | 2.25370 |
| Index of Refraction | 1.669 |
| InChIKey | QSBZDBNPXSVVHH-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(=O)c2cc(Br)ccc2o1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918300090 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
The standard molar enthalpies of formation of chromone-3-carboxylic acid, 6-methylchromone-2-carboxylic acid, and 6-methyl-4-chromanone determined by micro-combustion calorimetry. Flores H, et al.
J. Therm. Anal. Calorim. 117(1) , 433-37, (2014)
|
| MFCD01242619 |
| 6-bromochromone-2-carboxylic acid |