diisopropylphenylphosphate structure
|
Common Name | diisopropylphenylphosphate | ||
|---|---|---|---|---|
| CAS Number | 51496-03-8 | Molecular Weight | 258.25100 | |
| Density | 1.194g/cm3 | Boiling Point | 384.5ºC at 760 mmHg | |
| Molecular Formula | C12H19O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.3ºC | |
| Name | [2,3-di(propan-2-yl)phenyl] dihydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.194g/cm3 |
|---|---|
| Boiling Point | 384.5ºC at 760 mmHg |
| Molecular Formula | C12H19O4P |
| Molecular Weight | 258.25100 |
| Flash Point | 186.3ºC |
| Exact Mass | 258.10200 |
| PSA | 76.57000 |
| LogP | 3.40490 |
| Index of Refraction | 1.528 |
| InChIKey | SFFTXLYPBWITRH-UHFFFAOYSA-N |
| SMILES | CC(C)c1cccc(OP(=O)(O)O)c1C(C)C |
| HS Code | 2919900090 |
|---|
|
~%
diisopropylphen... CAS#:51496-03-8 |
| Literature: Jandorf et al. Journal of the American Chemical Society, 1952 , vol. 74, p. 1521 |
|
~%
diisopropylphen... CAS#:51496-03-8 |
| Literature: Siddall,T.H.; Prohaska,C.A. Journal of the American Chemical Society, 1962 , vol. 84, p. 3467 - 3473 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Diisopropylphenylphosphate |
| Diprphp |