alpha-Methyl-3-biphenylacetic acid structure
|
Common Name | alpha-Methyl-3-biphenylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 51498-07-8 | Molecular Weight | 226.27000 | |
| Density | 1.134g/cm3 | Boiling Point | 395.9ºC at 760 mmHg | |
| Molecular Formula | C15H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 292.7ºC | |
| Name | 2-(3-phenylphenyl)propanoic acid |
|---|
| Density | 1.134g/cm3 |
|---|---|
| Boiling Point | 395.9ºC at 760 mmHg |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27000 |
| Flash Point | 292.7ºC |
| Exact Mass | 226.09900 |
| PSA | 37.30000 |
| LogP | 3.54170 |
| Index of Refraction | 1.582 |
| InChIKey | OQMCVCHIWJWEHF-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)c1cccc(-c2ccccc2)c1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: Acute toxicity was determined 168 hr after a single ip injection to groups of four ma...
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL740240
|
|
Name: Analgesic activity against AcOH writhing after po administration.
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL783786
|
|
Name: Inhibitory activity on carrageenan-induced paw edema in rats 3h after po administrati...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL787889
|