3-Biphenylylacetic acid structure
|
Common Name | 3-Biphenylylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 23948-77-8 | Molecular Weight | 212.244 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 384.6±11.0 °C at 760 mmHg | |
| Molecular Formula | C14H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.5±14.4 °C | |
| Name | 2-(3-phenylphenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 384.6±11.0 °C at 760 mmHg |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.244 |
| Flash Point | 281.5±14.4 °C |
| Exact Mass | 212.083725 |
| PSA | 37.30000 |
| LogP | 3.26 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | VLQLJPWPRYUYMK-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1cccc(-c2ccccc2)c1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xi |
|---|---|
| HS Code | 2916399090 |
| Precursor 7 | |
|---|---|
| DownStream 2 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: ULK1_INH_LUMI_1536_1X%INH PRUN
|
|
Name: uHTS identification of small molecule modulators of Rev-erb Alpha.
Source: Burnham Center for Chemical Genomics
Target: N/A
External Id: SBCCG-A1016-RevErbaLBD-Primary-Assay
|
|
Name: Inhibitory activity on carrageenan-induced paw edema in rats 3h after po administrati...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL786502
|
|
Name: Analgesic activity against AcOH writhing after po administration.
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL783786
|
|
Name: Inhibitory activity on carrageenan-induced paw edema in rats 3h after po administrati...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL787889
|
|
Name: Acute toxicity was determined 168 hr after a single ip injection to groups of four ma...
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL720719
|
| 3-Biphenylylacetic acid |
| 3-BIPHENYLACETIC ACID |
| [1,1'-Biphenyl]-3-acetic acid |
| 1,1'-biphenyl-3-ylacetic acid |
| Biphenyl-3-ylacetic acid |