trans-4-Bromo-β-nitrostyrene structure
|
Common Name | trans-4-Bromo-β-nitrostyrene | ||
|---|---|---|---|---|
| CAS Number | 5153-71-9 | Molecular Weight | 228.043 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 318.9±17.0 °C at 760 mmHg | |
| Molecular Formula | C8H6BrNO2 | Melting Point | 148-150ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 146.7±20.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | trans-4-Bromo-beta-nitrostyrene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 318.9±17.0 °C at 760 mmHg |
| Melting Point | 148-150ºC(lit.) |
| Molecular Formula | C8H6BrNO2 |
| Molecular Weight | 228.043 |
| Flash Point | 146.7±20.9 °C |
| Exact Mass | 226.958176 |
| PSA | 45.82000 |
| LogP | 3.04 |
| Appearance of Characters | Crystalline Powder or Powder | Yellow to yellow-green |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | LSGVHLGCJIBLMB-AATRIKPKSA-N |
| SMILES | O=[N+]([O-])C=Cc1ccc(Br)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Chiral sulfamide-catalyzed asymmetric Michael addition of protected 3-hydroxypropanal to β-nitrostyrenes. Tortoioli S, et al.
Tetrahedron Lett. 53(15) , 1878-81, (2012)
|
| WN1U1R DE &&trans or (E)- Form |
| MFCD00191856 |
| Benzene, 1-bromo-4-[(E)-2-nitroethenyl]- |
| 1-bromo-4-[(E)-2-nitroethenyl]benzene |
| 1-Bromo-4-[(E)-2-nitrovinyl]benzene |
| trans-4-Bromo-β-nitrostyrene |