3'-O-(tert-butyldimethylsilyl)-2'-deoxyadenosine
3'-O-(tert-butyldimethylsilyl)-2'-deoxyadenosine structure
|
Common Name | 3'-O-(tert-butyldimethylsilyl)-2'-deoxyadenosine | ||
|---|---|---|---|---|
| CAS Number | 51549-31-6 | Molecular Weight | 365.50300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H27N5O3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H27N5O3Si |
|---|---|
| Molecular Weight | 365.50300 |
| Exact Mass | 365.18800 |
| PSA | 108.31000 |
| LogP | 2.65990 |
| InChIKey | RZJNKNBLADNWHG-QJPTWQEYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(n2cnc3c(N)ncnc32)OC1CO |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:958-09-8
CAS#:6698-29-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD29918153 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanol? |
| A: Molecular formula of [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanol is C16H27N5O3Si. |
| Q: What English synonyms does [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanol have? |
| A: English synonyms of [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanol: MFCD29918153. |
| Q: What is the LogP of [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanol? |
| A: LogP of [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanol is 2.65990. |
| Q: What is the polar surface area (PSA) of [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanol? |
| A: Polar surface area (PSA) of [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanol is 108.31000. |
| Q: What are the downstream products of [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanol? |
| A: Related downstream products(CAS) of [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanol: 958-09-8;6698-29-9. |
| Q: What is the InChIKey of [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanol? |
| A: InChIKey of [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanol is RZJNKNBLADNWHG-QJPTWQEYSA-N. |
| Q: What is the CAS number of [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanol? |
| A: CAS number of [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanol is 51549-31-6. |
| Q: What is the molecular weight of [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanol? |
| A: Molecular weight of [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanol is 365.50300. |
| Q: What is the SMILES notation of [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanol? |
| A: SMILES notation of [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanol is CC(C)(C)[Si](C)(C)OC1CC(n2cnc3c(N)ncnc32)OC1CO. |
| Q: What is the English name of [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanol? |
| A: The English name of [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanol is [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]methanol. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |