Trichothec-9-en-5-one, 3,7,15-tris(acetyloxy)-12,13-epoxy-, (3alpha,7alpha)- structure
|
Common Name | Trichothec-9-en-5-one, 3,7,15-tris(acetyloxy)-12,13-epoxy-, (3alpha,7alpha)- | ||
|---|---|---|---|---|
| CAS Number | 51550-28-8 | Molecular Weight | 422.42600 | |
| Density | 1.34g/cm3 | Boiling Point | 520.8ºC at 760 mmHg | |
| Molecular Formula | C21H26O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.9ºC | |
| Name | Vomitoxin, triacetoxy deriv. |
|---|
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 520.8ºC at 760 mmHg |
| Molecular Formula | C21H26O9 |
| Molecular Weight | 422.42600 |
| Flash Point | 225.9ºC |
| Exact Mass | 422.15800 |
| PSA | 117.73000 |
| LogP | 0.87470 |
| Index of Refraction | 1.55 |
| InChIKey | FUPMDISLTMETBI-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC12C(C=C(C)C(=O)C1OC(C)=O)OC1C(OC(C)=O)CC2(C)C12CO2 |
|
~95%
Trichothec-9-en... CAS#:51550-28-8 |
| Literature: Cameron; Colvin 1989 , # 5 p. 887 - 895 |
|
~96%
Trichothec-9-en... CAS#:51550-28-8 |
| Literature: Cameron, Stuart; Colvin, Ernest W. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1989 , p. 365 - 370 |
|
~%
Trichothec-9-en... CAS#:51550-28-8 |
| Literature: Cameron; Colvin 1989 , # 5 p. 887 - 895 |