9-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)xanthen-9-ol
9-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)xanthen-9-ol structure
|
Common Name | 9-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)xanthen-9-ol | ||
|---|---|---|---|---|
| CAS Number | 51582-47-9 | Molecular Weight | 363.37400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 9-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)xanthen-9-ol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H20F3NO2 |
|---|---|
| Molecular Weight | 363.37400 |
| Exact Mass | 363.14500 |
| PSA | 32.70000 |
| LogP | 4.32670 |
| InChIKey | ZIUNYNUCENTFPS-UHFFFAOYSA-N |
| SMILES | CN1CCC(C2(O)c3ccccc3Oc3ccc(C(F)(F)F)cc32)CC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
9-(1-methylpipe... CAS#:51582-47-9 |
| Literature: SmithKline Corporation Patent: US4086350 A1, 1978 ; |
|
~%
9-(1-methylpipe... CAS#:51582-47-9 |
| Literature: Kaiser,C. et al. Journal of Medicinal Chemistry, 1974 , vol. 17, p. 57 - 62 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![1-methyl-4-[2-(trifluoromethyl)xanthen-9-ylidene]piperidine structure](https://image.chemsrc.com/caspic/396/51582-52-6.png)
CAS#:51582-52-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 9H-Xanthen-9-ol,9-(1-methyl-4-piperidinyl)-2-(trifluoromethyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 9-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)xanthen-9-ol? |
| A: LogP of 9-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)xanthen-9-ol is 4.32670. |
| Q: What is the English name of 9-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)xanthen-9-ol? |
| A: The English name of 9-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)xanthen-9-ol is 9-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)xanthen-9-ol. |
| Q: What is the molecular weight of 9-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)xanthen-9-ol? |
| A: Molecular weight of 9-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)xanthen-9-ol is 363.37400. |
| Q: What is the Chinese name of 51582-47-9? |
| A: Chinese name of 51582-47-9 is 51582-47-9. |
| Q: What is the InChIKey of 9-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)xanthen-9-ol? |
| A: InChIKey of 9-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)xanthen-9-ol is ZIUNYNUCENTFPS-UHFFFAOYSA-N. |
| Q: What English synonyms does 9-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)xanthen-9-ol have? |
| A: English synonyms of 9-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)xanthen-9-ol: 9H-Xanthen-9-ol,9-(1-methyl-4-piperidinyl)-2-(trifluoromethyl). |
| Q: What is the polar surface area (PSA) of 9-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)xanthen-9-ol? |
| A: Polar surface area (PSA) of 9-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)xanthen-9-ol is 32.70000. |
| Q: What is the molecular formula of 9-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)xanthen-9-ol? |
| A: Molecular formula of 9-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)xanthen-9-ol is C20H20F3NO2. |
| Q: What are the downstream products of 9-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)xanthen-9-ol? |
| A: Related downstream products(CAS) of 9-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)xanthen-9-ol: 51582-52-6. |
| Q: What are the upstream materials of 9-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)xanthen-9-ol? |
| A: Related upstream materials(CAS) of 9-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)xanthen-9-ol: 1496-15-7;5570-77-4. |