2, 3-Diphenylthiirene 1-oxide structure
|
Common Name | 2, 3-Diphenylthiirene 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 5162-99-2 | Molecular Weight | 242.29300 | |
| Density | 1.365g/cm3 | Boiling Point | 476.6ºC at 760 mmHg | |
| Molecular Formula | C14H10O2S | Melting Point | N/A | |
| MSDS | USA | Flash Point | 316.8ºC | |
| Name | 2,3-diphenylthiirene 1,1-dioxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.365g/cm3 |
|---|---|
| Boiling Point | 476.6ºC at 760 mmHg |
| Molecular Formula | C14H10O2S |
| Molecular Weight | 242.29300 |
| Flash Point | 316.8ºC |
| Exact Mass | 242.04000 |
| PSA | 42.52000 |
| LogP | 4.02160 |
| Index of Refraction | 1.678 |
| InChIKey | FVDCQEMOBAKISG-UHFFFAOYSA-N |
| SMILES | O=S1(=O)C(c2ccccc2)=C1c1ccccc1 |
| HS Code | 2902909090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| HS Code | 2902909090 |
|---|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
|
Name: Antifertility activity in 1 to 9 days pregnancy Charles River CD rat assessed as redu...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL3284782
|
| Thiirene,1,1-dioxide |
| 2,3-DIFLUORO-4-METHYLBENZYL BROMIDE |
| Diphenylthiirene 1,1-dioxide |
| 2,3-Diphenylthiirene dioxide |
| Diphenylthiirene dioxide |
| 2,3-diphenyl-thiirene 1,1-dioxide |