4,5-Diphenyl-1H-1,2,3-triazole structure
|
Common Name | 4,5-Diphenyl-1H-1,2,3-triazole | ||
|---|---|---|---|---|
| CAS Number | 5533-73-3 | Molecular Weight | 249.30600 | |
| Density | 1.14g/cm3 | Boiling Point | 448.4ºC at 760 mmHg | |
| Molecular Formula | C14H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225ºC | |
| Name | N-[2-(3,4-dimethoxyphenyl)ethyl]cyclopropanecarboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 448.4ºC at 760 mmHg |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.30600 |
| Flash Point | 225ºC |
| Exact Mass | 249.13600 |
| PSA | 51.05000 |
| LogP | 2.61280 |
| Index of Refraction | 1.545 |
| InChIKey | QPBWHEBUYQQIJN-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCNC(=O)C2CC2)cc1OC |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,5-diphenyl-1H-1,2,3-triazole |
| 4,5-diphenyltriazole |