3-(4-methoxy-3-phenylmethoxy-phenyl)-2-oxo-propanoic acid structure
|
Common Name | 3-(4-methoxy-3-phenylmethoxy-phenyl)-2-oxo-propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 5164-91-0 | Molecular Weight | 300.30600 | |
| Density | 1.255g/cm3 | Boiling Point | 469.6ºC at 760 mmHg | |
| Molecular Formula | C17H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.4ºC | |
| Name | 3-(4-methoxy-3-phenylmethoxyphenyl)-2-oxopropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 469.6ºC at 760 mmHg |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.30600 |
| Flash Point | 171.4ºC |
| Exact Mass | 300.10000 |
| PSA | 72.83000 |
| LogP | 2.47040 |
| Index of Refraction | 1.582 |
| InChIKey | GMFXKTPSYBSNQM-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC(=O)C(=O)O)cc1OCc1ccccc1 |
| HS Code | 2918990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-[3-(benzyloxy)-4-methoxyphenyl]-2-oxopropanoic acid |