2-[(3-chloronaphthalen-1-yl)amino]benzoic acid structure
|
Common Name | 2-[(3-chloronaphthalen-1-yl)amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 51671-05-7 | Molecular Weight | 297.73600 | |
| Density | 1.39g/cm3 | Boiling Point | 464.8ºC at 760 mmHg | |
| Molecular Formula | C17H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.9ºC | |
| Name | 2-[(3-chloronaphthalen-1-yl)amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 464.8ºC at 760 mmHg |
| Molecular Formula | C17H12ClNO2 |
| Molecular Weight | 297.73600 |
| Flash Point | 234.9ºC |
| Exact Mass | 297.05600 |
| PSA | 49.33000 |
| LogP | 5.00800 |
| Index of Refraction | 1.728 |
| InChIKey | BUSHGHMSCCWJSO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1Nc1cc(Cl)cc2ccccc12 |
| HS Code | 2922499990 |
|---|
|
~%
2-[(3-chloronap... CAS#:51671-05-7 |
| Literature: Ikeda Mohando Patent: DE2323956 , 1973 ; Chem.Abstr., 1974 , vol. 80, # 59782 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2-((3-Chloro-1-naphthalenyl)amino)benzoic acid |
| Benzoic acid,2-((3-chloro-1-naphthalenyl)amino) |
| N-(3-CHLORO-NAPHTHALEN-1-YL)ANTHRANILIC ACID |
| N-(3-Chloro-1-naphthyl)anthranilic acid |