2-[(3-fluoronaphthalen-1-yl)amino]benzoic acid
Modify Date: 2025-09-07 21:55:31
![2-[(3-fluoronaphthalen-1-yl)amino]benzoic acid Structure](https://image.chemsrc.com/caspic/163/51671-19-3.png)
2-[(3-fluoronaphthalen-1-yl)amino]benzoic acid structure
|
Common Name | 2-[(3-fluoronaphthalen-1-yl)amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 51671-19-3 | Molecular Weight | 281.28100 | |
| Density | 1.363g/cm3 | Boiling Point | 436.2ºC at 760 mmHg | |
| Molecular Formula | C17H12FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.6ºC | |
| Name | 2-[(3-fluoronaphthalen-1-yl)amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.363g/cm3 |
|---|---|
| Boiling Point | 436.2ºC at 760 mmHg |
| Molecular Formula | C17H12FNO2 |
| Molecular Weight | 281.28100 |
| Flash Point | 217.6ºC |
| Exact Mass | 281.08500 |
| PSA | 49.33000 |
| LogP | 4.49370 |
| Index of Refraction | 1.707 |
| InChIKey | GOPBMTFLCCCNPL-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1Nc1cc(F)cc2ccccc12 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid,2-((3-fluoro-1-naphthalenyl)amino) |
| 2-((3-Fluoro-1-naphthalenyl)amino)benzoic acid |
| N-(3-Fluoro-1-naphthyl)anthranilic acid |