Thiazole, 2-chloro-4-(5-nitro-2-furanyl)- (9CI)
Modify Date: 2025-08-26 14:31:57
Thiazole, 2-chloro-4-(5-nitro-2-furanyl)- (9CI) structure
|
Common Name | Thiazole, 2-chloro-4-(5-nitro-2-furanyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 51728-03-1 | Molecular Weight | 230.62800 | |
| Density | 1.601g/cm3 | Boiling Point | 398.5ºC at 760 mmHg | |
| Molecular Formula | C7H3ClN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.8ºC | |
| Name | 2-chloro-4-(5-nitrofuran-2-yl)-1,3-thiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.601g/cm3 |
|---|---|
| Boiling Point | 398.5ºC at 760 mmHg |
| Molecular Formula | C7H3ClN2O3S |
| Molecular Weight | 230.62800 |
| Flash Point | 194.8ºC |
| Exact Mass | 229.95500 |
| PSA | 100.09000 |
| LogP | 3.48790 |
| Index of Refraction | 1.627 |
| InChIKey | PXNLCDVUTAKRMT-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(-c2csc(Cl)n2)o1 |
| HS Code | 2934100090 |
|---|
|
~%
Thiazole, 2-chl... CAS#:51728-03-1 |
| Literature: Sherman,W.R.; Dickson,D.E. Journal of Organic Chemistry, 1962 , vol. 27, p. 1351 - 1355 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-Chloro-4-(5-nitro-2-furanyl)thiazole |
| Thiazole,2-chloro-4-(5-nitro-2-furyl) |
| 2-Chloro-4-(5-nitro-2-furyl)thiazole |
| Thiazole,2-chloro-4-(5-nitro-2-furanyl) |