2-Oxo-1,2-dihydro-1,8-naphthyridine-3-carboxylic acid structure
|
Common Name | 2-Oxo-1,2-dihydro-1,8-naphthyridine-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 5175-14-4 | Molecular Weight | 190.15600 | |
| Density | 1.496g/cm3 | Boiling Point | 549.1ºC at 760mmHg | |
| Molecular Formula | C9H6N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.9ºC | |
| Name | 2-Oxo-1,2-dihydro-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.496g/cm3 |
|---|---|
| Boiling Point | 549.1ºC at 760mmHg |
| Molecular Formula | C9H6N2O3 |
| Molecular Weight | 190.15600 |
| Flash Point | 285.9ºC |
| Exact Mass | 190.03800 |
| PSA | 83.05000 |
| LogP | 0.62130 |
| Index of Refraction | 1.667 |
| InChIKey | BFVQMOCETIVORP-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc2cccnc2[nH]c1=O |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~%
2-Oxo-1,2-dihyd... CAS#:5175-14-4 |
| Literature: MERCK and CO., INC.; ISTITUTO DI RICERCHE DI BIOLOGIA MOLECOLARE P. ANGELETTI S.P.A. Patent: WO2008/57209 A1, 2008 ; Location in patent: Page/Page column 66 ; WO 2008/057209 A1 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-oxo-1H-1,8-naphthyridine-3-carboxylic acid |