PHENYL PHENYLPHOSPHORAMIDOCHLORIDATE structure
|
Common Name | PHENYL PHENYLPHOSPHORAMIDOCHLORIDATE | ||
|---|---|---|---|---|
| CAS Number | 51766-21-3 | Molecular Weight | 267.64800 | |
| Density | 1.363g/cm3 | Boiling Point | 365.8ºC at 760 mmHg | |
| Molecular Formula | C12H11ClNO2P | Melting Point | 132-134ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 175ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-[chloro(phenoxy)phosphoryl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.363g/cm3 |
|---|---|
| Boiling Point | 365.8ºC at 760 mmHg |
| Melting Point | 132-134ºC(lit.) |
| Molecular Formula | C12H11ClNO2P |
| Molecular Weight | 267.64800 |
| Flash Point | 175ºC |
| Exact Mass | 267.02200 |
| PSA | 48.14000 |
| LogP | 4.59740 |
| Appearance of Characters | solid |
| Index of Refraction | 1.622 |
| InChIKey | ZUQYQPGYEFBITH-UHFFFAOYSA-N |
| SMILES | O=P(Cl)(Nc1ccccc1)Oc1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2931900090 |
|
~67%
PHENYL PHENYLPH... CAS#:51766-21-3 |
| Literature: Mestres, Ramon; Palomo, Claudio Synthesis, 1981 , # 3 p. 218 - 220 |
|
~59%
PHENYL PHENYLPH... CAS#:51766-21-3 |
| Literature: Mestres, Ramon; Palomo, Claudio Synthesis, 1982 , # 4 p. 288 - 291 |
|
~%
PHENYL PHENYLPH... CAS#:51766-21-3 |
| Literature: Michaelis Justus Liebigs Annalen der Chemie, 1903 , vol. 326, p. 220,222 |
|
~%
PHENYL PHENYLPH... CAS#:51766-21-3 |
| Literature: Michaelis Justus Liebigs Annalen der Chemie, 1903 , vol. 326, p. 220,222 |
| Precursor 5 | |
|---|---|
| DownStream 4 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|
Inhibition of chymotrypsin by phenyl N-phenyl-phosphoramidochloridate.
Biochem. Soc. Trans. 20(3) , 283S, (1992)
|
| O-phenyl-N-phenylphosphoroamidochloridate |
| phenyl N-phenylphosphoramidochloridate |
| O-phenyl N-phenyl-phosphoramidochloridate |
| N-Phenylphosphoramidochloridic acid phenyl ester |
| EINECS 257-400-5 |
| MFCD00003029 |
| phenyl N-phenylphosphoroamidochloridate |
| 3P-Cl |
| ZUQYQPGYEFBITH-UHFFFAOYSA |