N-(4-hydroxy-2-methylphenyl)benzenesulfonamide structure
|
Common Name | N-(4-hydroxy-2-methylphenyl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 51767-42-1 | Molecular Weight | 263.31200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-hydroxy-2-methylphenyl)benzenesulfonamide |
|---|
| Molecular Formula | C13H13NO3S |
|---|---|
| Molecular Weight | 263.31200 |
| Exact Mass | 263.06200 |
| PSA | 74.78000 |
| LogP | 3.65520 |
| InChIKey | MFXQIOMFXXIRQI-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)ccc1NS(=O)(=O)c1ccccc1 |
|
~%
N-(4-hydroxy-2-... CAS#:51767-42-1 |
| Literature: Adams; Locker Journal of the American Chemical Society, 1951 , vol. 73, p. 1145,1148 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |