VDM-11 structure
|
Common Name | VDM-11 | ||
|---|---|---|---|---|
| CAS Number | 313998-81-1 | Molecular Weight | 409.604 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 586.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C27H39NO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 308.5±30.1 °C | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
| Name | N-(4-hydroxy-2-methylphenyl)icosa-5,8,11,14-tetraenamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 586.6±50.0 °C at 760 mmHg |
| Molecular Formula | C27H39NO2 |
| Molecular Weight | 409.604 |
| Flash Point | 308.5±30.1 °C |
| Exact Mass | 409.298065 |
| PSA | 49.33000 |
| LogP | 8.09 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | WUZWFRWVRHLXHZ-ZKWNWVNESA-N |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)Nc1ccc(O)cc1C |
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H312-H332-H334 |
| Precautionary Statements | P261-P280-P342 + P311 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 20/21/22-42 |
| Safety Phrases | 23-36-45 |
| RIDADR | NONH for all modes of transport |
|
Overlap between the ligand recognition properties of the anandamide transporter and the VR1 vanilloid receptor: inhibitors of anandamide uptake with negligible capsaicin-like activity.
FEBS Lett. 483 , 52-56, (2000) Some synthetic agonists of the VR1 vanilloid (capsaicin) receptor also inhibit the facilitated transport into cells of the endogenous cannabinoid anandamide (arachidonoylethanolamide, AEA). Here we te... |
| Eledoisin-Related Peptide |
| VDM 11 |
| VDM11 |
| (5Z,8Z,11Z,14Z)-N-(4-Hydroxy-2-methylphenyl)-5,8,11,14-icosatetraenamide |
| N-(4-Hydroxy-2-methylphenyl)arachidonylamide |
| MFCD04037552 |
| 5,8,11,14-Eicosatetraenamide, N-(4-hydroxy-2-methylphenyl)-, (5Z,8Z,11Z,14Z)- |
| VDM-11 |
| (5Z,8Z,11Z,14Z)-N-(4-Hydroxy-2-methylphenyl)icosa-5,8,11,14-tetraenamide |