2-(4-nitrophenyl)-5-phenylthiophene structure
|
Common Name | 2-(4-nitrophenyl)-5-phenylthiophene | ||
|---|---|---|---|---|
| CAS Number | 51776-05-7 | Molecular Weight | 281.32900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H11NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-nitrophenyl)-5-phenylthiophene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H11NO2S |
|---|---|
| Molecular Weight | 281.32900 |
| Exact Mass | 281.05100 |
| PSA | 74.06000 |
| LogP | 5.51350 |
| InChIKey | BTOFUQVKQBHYQW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(-c3ccccc3)s2)cc1 |
|
~%
2-(4-nitropheny... CAS#:51776-05-7 |
| Literature: Kirsch, Gilbert; Prim, Damien; Leising, Frederic; Mignani, Gerard Journal of Heterocyclic Chemistry, 1994 , vol. 31, # 4 p. 1005 - 1010 |
|
~%
2-(4-nitropheny... CAS#:51776-05-7 |
| Literature: Kirsch, Gilbert; Prim, Damien; Leising, Frederic; Mignani, Gerard Journal of Heterocyclic Chemistry, 1994 , vol. 31, # 4 p. 1005 - 1010 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Thiophene,2-(4-nitrophenyl)-5-phenyl |