2-Piperidin-2-yl-1H-benzoimidazole structure
|
Common Name | 2-Piperidin-2-yl-1H-benzoimidazole | ||
|---|---|---|---|---|
| CAS Number | 51785-23-0 | Molecular Weight | 201.26800 | |
| Density | 1.167g/cm3 | Boiling Point | 441.3ºC at 760 mmHg | |
| Molecular Formula | C12H15N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-piperidin-2-yl-1H-benzimidazole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.167g/cm3 |
|---|---|
| Boiling Point | 441.3ºC at 760 mmHg |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.26800 |
| Flash Point | 220.7ºC |
| Exact Mass | 201.12700 |
| PSA | 40.71000 |
| LogP | 2.70630 |
| Index of Refraction | 1.628 |
| InChIKey | WADQLYMWCOLMMB-UHFFFAOYSA-N |
| SMILES | c1ccc2[nH]c(C3CCCCN3)nc2c1 |
| Storage condition | 2-8°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-(Piperidin-2-yl)-1H-benzo[d]imidazole |
| 2-(2-Piperidinyl)-1H-benzimidazole |
| 2-(2-piperidyl)benzimidazole |
| 2-(piperidin-2-yl)-1H-benzimidazole |
| 2-(piperidin-2-yl)-1H-1,3-benzodiazole |
| 2-Piperidin-2-yl-1H-benzoimidazole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-piperidin-2-yl-1H-benzimidazole? |
| A: InChIKey of 2-piperidin-2-yl-1H-benzimidazole is WADQLYMWCOLMMB-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-piperidin-2-yl-1H-benzimidazole? |
| A: CAS number of 2-piperidin-2-yl-1H-benzimidazole is 51785-23-0. |
| Q: What are the storage conditions for 2-piperidin-2-yl-1H-benzimidazole? |
| A: Storage conditions for 2-piperidin-2-yl-1H-benzimidazole: 2-8°C. |
| Q: What is the SMILES notation of 2-piperidin-2-yl-1H-benzimidazole? |
| A: SMILES notation of 2-piperidin-2-yl-1H-benzimidazole is c1ccc2[nH]c(C3CCCCN3)nc2c1. |
| Q: What is the molecular weight of 2-piperidin-2-yl-1H-benzimidazole? |
| A: Molecular weight of 2-piperidin-2-yl-1H-benzimidazole is 201.26800. |
| Q: What is the polar surface area (PSA) of 2-piperidin-2-yl-1H-benzimidazole? |
| A: Polar surface area (PSA) of 2-piperidin-2-yl-1H-benzimidazole is 40.71000. |
| Q: What is the boiling point of 2-piperidin-2-yl-1H-benzimidazole? |
| A: Boiling point of 2-piperidin-2-yl-1H-benzimidazole is 441.3ºC at 760 mmHg. |
| Q: What is the English name of 2-piperidin-2-yl-1H-benzimidazole? |
| A: The English name of 2-piperidin-2-yl-1H-benzimidazole is 2-piperidin-2-yl-1H-benzimidazole. |
| Q: What is the molecular formula of 2-piperidin-2-yl-1H-benzimidazole? |
| A: Molecular formula of 2-piperidin-2-yl-1H-benzimidazole is C12H15N3. |
| Q: What is the LogP of 2-piperidin-2-yl-1H-benzimidazole? |
| A: LogP of 2-piperidin-2-yl-1H-benzimidazole is 2.70630. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |