Dihydrooxoepistephamiersine structure
|
Common Name | Dihydrooxoepistephamiersine | ||
|---|---|---|---|---|
| CAS Number | 51804-69-4 | Molecular Weight | 405.442 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 611.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C21H27NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 323.9±31.5 °C | |
| Name | (6β,7β,8β,10β)-6-Hydroxy-3,4,7,8-tetramethoxy-17-methyl-8,10-epox yhasubanan-16-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 611.9±55.0 °C at 760 mmHg |
| Molecular Formula | C21H27NO7 |
| Molecular Weight | 405.442 |
| Flash Point | 323.9±31.5 °C |
| Exact Mass | 405.178741 |
| PSA | 86.69000 |
| LogP | 2.12 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | OUWUCZBFYDREBB-WYCRWZGLSA-N |
| SMILES | COc1ccc2c(c1OC)C13CC(=O)N(C)C14CC2OC4(OC)C(OC)C(O)C3 |
| Hazard Codes | Xi |
|---|
|
~%
Dihydrooxoepist... CAS#:51804-69-4 |
| Literature: Matsui; Watanabe; Ibuka; Tanaka Chemical and Pharmaceutical Bulletin, 1975 , vol. 23, # 6 p. 1323 - 1335 |
|
~%
Dihydrooxoepist... CAS#:51804-69-4 |
| Literature: Matsui; Watanabe; Ibuka; Tanaka Chemical and Pharmaceutical Bulletin, 1975 , vol. 23, # 6 p. 1323 - 1335 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Hasubanan-16-one, 8,10-epoxy-6-hydroxy-3,4,7,8-tetramethoxy-17-methyl-, (6β,7β,10β)- |
| (6β,7β,10β)-6-Hydroxy-3,4,7,8-tetramethoxy-17-methyl-8,10-epoxyhasubanan-16-one |