dimethyl (3-oxo-2-pentylcyclopentyl)malonate structure
|
Common Name | dimethyl (3-oxo-2-pentylcyclopentyl)malonate | ||
|---|---|---|---|---|
| CAS Number | 51806-23-6 | Molecular Weight | 284.34800 | |
| Density | 1.075g/cm3 | Boiling Point | 360.5ºC at 760mmHg | |
| Molecular Formula | C15H24O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155ºC | |
| Name | dimethyl 2-(3-oxo-2-pentylcyclopentyl)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.075g/cm3 |
|---|---|
| Boiling Point | 360.5ºC at 760mmHg |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.34800 |
| Flash Point | 155ºC |
| Exact Mass | 284.16200 |
| PSA | 69.67000 |
| LogP | 2.12420 |
| Index of Refraction | 1.465 |
| InChIKey | ROZSFNKSMIZYLM-UHFFFAOYSA-N |
| SMILES | CCCCCC1C(=O)CCC1C(C(=O)OC)C(=O)OC |
| HS Code | 2918300090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| pro030 |