2-fluoro-4-methylbenzenesulfonyl chloride structure
|
Common Name | 2-fluoro-4-methylbenzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 518070-29-6 | Molecular Weight | 208.63800 | |
| Density | 1.423g/cm3 | Boiling Point | 257.3ºC at 760 mmHg | |
| Molecular Formula | C7H6ClFO2S | Melting Point | N/A | |
| MSDS | USA | Flash Point | 109.4ºC | |
| Name | 2-Fluoro-4-methylbenzene-1-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.423g/cm3 |
|---|---|
| Boiling Point | 257.3ºC at 760 mmHg |
| Molecular Formula | C7H6ClFO2S |
| Molecular Weight | 208.63800 |
| Flash Point | 109.4ºC |
| Exact Mass | 207.97600 |
| PSA | 42.52000 |
| LogP | 3.14240 |
| Index of Refraction | 1.528 |
| InChIKey | SDBFDPOFXLVGQF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Cl)c(F)c1 |
| Storage condition | 2~8℃ |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-fluoro-4-methylbenzenesulfonyl chloride |
| MFCD03094330 |