Alrestatin (sodium) structure
|
Common Name | Alrestatin (sodium) | ||
|---|---|---|---|---|
| CAS Number | 51876-97-2 | Molecular Weight | 277.20700 | |
| Density | 1.511g/cm3 | Boiling Point | 512.7ºC at 760mmHg | |
| Molecular Formula | C14H8NNaO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.9ºC | |
Use of Alrestatin (sodium)Alrestatin sodium is an inhibitor of aldose reductase, an enzyme involved in the pathogenesis of complications of diabetes mellitus, including diabetic neuropathy. |
| Name | sodium,2-(1,3-dioxobenzo[de]isoquinolin-2-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Description | Alrestatin sodium is an inhibitor of aldose reductase, an enzyme involved in the pathogenesis of complications of diabetes mellitus, including diabetic neuropathy. |
|---|---|
| Related Catalog |
| Density | 1.511g/cm3 |
|---|---|
| Boiling Point | 512.7ºC at 760mmHg |
| Molecular Formula | C14H8NNaO4 |
| Molecular Weight | 277.20700 |
| Flash Point | 263.9ºC |
| Exact Mass | 277.03500 |
| PSA | 79.20000 |
| InChIKey | FKZUETPACPDEAD-UHFFFAOYSA-M |
| SMILES | O=C([O-])CN1C(=O)c2cccc3cccc(c23)C1=O.[Na+] |
| Storage condition | 2-8℃ |
| UNII-018XNU6812 |
| Alrestatin sodium (USAN) |
| ALRESTATIN SODIUM |
| Alrestatin natrium |
| Alrestatin (sodium) |