2-NITRO-5-(PHENYLACETYLAMINO)-BENZOIC ACID structure
|
Common Name | 2-NITRO-5-(PHENYLACETYLAMINO)-BENZOIC ACID | ||
|---|---|---|---|---|
| CAS Number | 52033-70-2 | Molecular Weight | 300.26600 | |
| Density | 1.446g/cm3 | Boiling Point | 599.6ºC at 760 mmHg | |
| Molecular Formula | C15H12N2O5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 316.4ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 2-nitro-5-[(2-phenylacetyl)amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.446g/cm3 |
|---|---|
| Boiling Point | 599.6ºC at 760 mmHg |
| Molecular Formula | C15H12N2O5 |
| Molecular Weight | 300.26600 |
| Flash Point | 316.4ºC |
| Exact Mass | 300.07500 |
| PSA | 112.22000 |
| LogP | 3.07040 |
| Index of Refraction | 1.68 |
| InChIKey | QHVQEQRGDKOHHC-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccccc1)Nc1ccc([N+](=O)[O-])c(C(=O)O)c1 |
| Storage condition | 2-8°C |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H315-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R37/38 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2924299090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Improving the diastereoselectivity of penicillin G acylase for ampicillin synthesis from racemic substrates.
Protein Eng. Des. Sel. 25(3) , 135-44, (2012) Semi-synthetic β-lactam antibiotics are synthesized enzymatically with the use of penicillin G acylase (PGA). Currently, PGA only exhibits weak diastereoselectivity with respect to the alpha amino gro... |
|
|
Preparation and general properties of crystalline penicillin acylase from Escherichia coli ATCC 11 105.
Hoppe. Seylers. Z. Physiol. Chem. 354 , 45, (1974)
|
|
|
New active site oriented glyoxyl-agarose derivatives of Escherichia coli penicillin G acylase.
BMC Biotechnol. 7 , 54, (2007) Immobilized Penicillin G Acylase (PGA) derivatives are biocatalysts that are industrially used for the hydrolysis of Penicillin G by fermentation and for the kinetically controlled synthesis of semi-s... |
| 6-Nitro-3-(phenylacetamido)benzoic acid |
| 6-Nitro-3-phenylacetamidobenzoesaeure |
| 2-nitro-5-(2-phenylacetylamino)benzoic acid |
| NIPAB |
| 2-Nitro-5-[(phenylacetyl)amino]benzoic acid |