1-(4-hydroxyphenyl)-3-phenyl-propane-1,3-dione structure
|
Common Name | 1-(4-hydroxyphenyl)-3-phenyl-propane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 52046-71-6 | Molecular Weight | 240.25400 | |
| Density | 1.23g/cm3 | Boiling Point | 455.8ºC at 760 mmHg | |
| Molecular Formula | C15H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.6ºC | |
| Name | 1-(4-hydroxyphenyl)-3-phenylpropane-1,3-dione |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 455.8ºC at 760 mmHg |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.25400 |
| Flash Point | 243.6ºC |
| Exact Mass | 240.07900 |
| PSA | 54.37000 |
| LogP | 2.84790 |
| Index of Refraction | 1.61 |
| InChIKey | UKQHHKBUTVQHSN-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)c1ccc(O)cc1)c1ccccc1 |
|
~84%
1-(4-hydroxyphe... CAS#:52046-71-6 |
| Literature: Jin, Hao; Zhang, Wei; Wang, Dan; Chu, Zengze; Shen, Zhihao; Zou, Dechun; Fan, Xinghe; Zhou, Qifeng Macromolecules, 2011 , vol. 44, # 24 p. 9556 - 9564 |
|
~%
1-(4-hydroxyphe... CAS#:52046-71-6 |
| Literature: Biophysica, Inc. Patent: US6123928 A1, 2000 ; |
|
~%
1-(4-hydroxyphe... CAS#:52046-71-6 |
| Literature: Hauser; Eby Journal of Organic Chemistry, 1957 , vol. 22, p. 909,911 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |