1-(4-nitrophenyl)-3-phenyl-propane-1,3-dione structure
|
Common Name | 1-(4-nitrophenyl)-3-phenyl-propane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 5400-95-3 | Molecular Weight | 269.25200 | |
| Density | 1.289g/cm3 | Boiling Point | 465.1ºC at 760 mmHg | |
| Molecular Formula | C15H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.5ºC | |
| Name | 1-(4-nitrophenyl)-3-phenylpropane-1,3-dione |
|---|
| Density | 1.289g/cm3 |
|---|---|
| Boiling Point | 465.1ºC at 760 mmHg |
| Molecular Formula | C15H11NO4 |
| Molecular Weight | 269.25200 |
| Flash Point | 228.5ºC |
| Exact Mass | 269.06900 |
| PSA | 79.96000 |
| LogP | 3.57370 |
| Index of Refraction | 1.61 |
| InChIKey | MIVNAJMLVLKIJI-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)c1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| Precursor 9 | |
|---|---|
| DownStream 6 | |
|
Name: qHTS screening for TAG (triacylglycerol) accumulators in algae
Source: 11812
Target: N/A
External Id: FATTTLab-Algae-Lipid
|
|
Name: A High Throughput Screening Assay for Inhibitors of Bacterial Motility in Vibrio chol...
Source: Southern Research Institute
Target: N/A
External Id: CHOL_MOT
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|