N-(4-methylphenyl)decanamide
Modify Date: 2025-09-30 06:45:38
N-(4-methylphenyl)decanamide structure
|
Common Name | N-(4-methylphenyl)decanamide | ||
|---|---|---|---|---|
| CAS Number | 52097-66-2 | Molecular Weight | 261.40200 | |
| Density | 0.965g/cm3 | Boiling Point | 412.9ºC at 760 mmHg | |
| Molecular Formula | C17H27NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.7ºC | |
| Name | N-(4-methylphenyl)decanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.965g/cm3 |
|---|---|
| Boiling Point | 412.9ºC at 760 mmHg |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.40200 |
| Flash Point | 253.7ºC |
| Exact Mass | 261.20900 |
| PSA | 29.10000 |
| LogP | 5.14720 |
| Index of Refraction | 1.52 |
| InChIKey | FADMNQRJNUIYBR-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)Nc1ccc(C)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
N-(4-methylphen... CAS#:52097-66-2 |
| Literature: Achaya Biochemical Journal, 1949 , vol. 44, p. 561,564 |
|
~%
N-(4-methylphen... CAS#:52097-66-2 |
| Literature: Robertson Journal of the Chemical Society, 1908 , vol. 93, p. 1037 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| p-Decanotoluidide |