5-Chloro-2-(trifluoromethyl)benzoic acid methyl ester structure
|
Common Name | 5-Chloro-2-(trifluoromethyl)benzoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 521064-74-4 | Molecular Weight | 238.59100 | |
| Density | 1.38g/cm3 | Boiling Point | 258.8ºC at 760 mmHg | |
| Molecular Formula | C9H6ClF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 105.2ºC | |
| Name | Methyl 5-chloro-2-(trifluoromethyl)benzoate |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 258.8ºC at 760 mmHg |
| Molecular Formula | C9H6ClF3O2 |
| Molecular Weight | 238.59100 |
| Flash Point | 105.2ºC |
| Exact Mass | 238.00100 |
| PSA | 26.30000 |
| LogP | 3.14540 |
| Index of Refraction | 1.466 |
| InChIKey | NILRXMRLNGSFLM-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Cl)ccc1C(F)(F)F |
|
~94%
5-Chloro-2-(tri... CAS#:521064-74-4 |
| Literature: ELI LILLY AND COMPANY Patent: US2012/302608 A1, 2012 ; Location in patent: Page/Page column 8 ; |