4-methyl-N-(4-methylphenyl)-3-(pyridin-2-ylsulfamoyl)benzamide structure
|
Common Name | 4-methyl-N-(4-methylphenyl)-3-(pyridin-2-ylsulfamoyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 5211-15-4 | Molecular Weight | 381.44800 | |
| Density | 1.346g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H19N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methyl-N-(4-methylphenyl)-3-(pyridin-2-ylsulfamoyl)benzamide |
|---|
| Density | 1.346g/cm3 |
|---|---|
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.44800 |
| Exact Mass | 381.11500 |
| PSA | 96.54000 |
| LogP | 4.97830 |
| Index of Refraction | 1.656 |
| InChIKey | YASSNNSHGATMSF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)c2ccc(C)c(S(=O)(=O)Nc3ccccn3)c2)cc1 |
|
~%
4-methyl-N-(4-m... CAS#:5211-15-4 |
| Literature: Ross,S.D. et al. Journal of Organic Chemistry, 1966 , vol. 31, p. 133 - 137 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |