1-(4-chloro-3,5-dinitrophenyl)ethanone structure
|
Common Name | 1-(4-chloro-3,5-dinitrophenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 52129-70-1 | Molecular Weight | 244.58900 | |
| Density | 1.561g/cm3 | Boiling Point | 313.9ºC at 760 mmHg | |
| Molecular Formula | C8H5ClN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.7ºC | |
| Name | 1-(4-chloro-3,5-dinitrophenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.561g/cm3 |
|---|---|
| Boiling Point | 313.9ºC at 760 mmHg |
| Molecular Formula | C8H5ClN2O5 |
| Molecular Weight | 244.58900 |
| Flash Point | 143.7ºC |
| Exact Mass | 243.98900 |
| PSA | 108.71000 |
| LogP | 3.40540 |
| Index of Refraction | 1.609 |
| InChIKey | HRQFCDXXFJOADN-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1 |
| HS Code | 2914700090 |
|---|
|
~85%
1-(4-chloro-3,5... CAS#:52129-70-1 |
| Literature: Buckman Laboratories, Inc. Patent: US3933472 A1, 1976 ; |
|
~%
1-(4-chloro-3,5... CAS#:52129-70-1 |
| Literature: Wright,J.B. et al. Journal of Medicinal Chemistry, 1978 , vol. 21, p. 930 - 935 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4'-Chloro-3',5'-dinitroacetophenone |
| 1-(4-chloro-3,5-dinitro-phenyl)-ethanone |
| Ethanone,1-(4-chloro-3,5-dinitrophenyl) |