2,4,6-trimethyl-N-phenyl-benzamide structure
|
Common Name | 2,4,6-trimethyl-N-phenyl-benzamide | ||
|---|---|---|---|---|
| CAS Number | 5215-40-7 | Molecular Weight | 239.31200 | |
| Density | 1.102g/cm3 | Boiling Point | 327.9ºC at 760 mmHg | |
| Molecular Formula | C16H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.3ºC | |
| Name | 2,4,6-trimethyl-N-phenylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.102g/cm3 |
|---|---|
| Boiling Point | 327.9ºC at 760 mmHg |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.31200 |
| Flash Point | 198.3ºC |
| Exact Mass | 239.13100 |
| PSA | 29.10000 |
| LogP | 3.93710 |
| Index of Refraction | 1.61 |
| InChIKey | JLZPOZUKBWWZBR-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C(=O)Nc2ccccc2)c(C)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| benzamide,2,4,6-trimethyl-n-phenyl |