3-methyl-4-phenylspiro[4H-[1,2,4,5]oxatriazino[5,4-b]phthalazine-1,1'-cyclohexane]-6,11-dione structure
|
Common Name | 3-methyl-4-phenylspiro[4H-[1,2,4,5]oxatriazino[5,4-b]phthalazine-1,1'-cyclohexane]-6,11-dione | ||
|---|---|---|---|---|
| CAS Number | 52165-40-9 | Molecular Weight | 377.43600 | |
| Density | 1.36g/cm3 | Boiling Point | 546.9ºC at 760 mmHg | |
| Molecular Formula | C22H23N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.5ºC | |
| Name | 3-methyl-4-phenylspiro[4H-[1,2,4,5]oxatriazino[5,4-b]phthalazine-1,1'-cyclohexane]-6,11-dione |
|---|
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 546.9ºC at 760 mmHg |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.43600 |
| Flash Point | 284.5ºC |
| Exact Mass | 377.17400 |
| PSA | 56.47000 |
| LogP | 3.14190 |
| Index of Refraction | 1.685 |
| InChIKey | FWWVWEUNDFFHFP-UHFFFAOYSA-N |
| SMILES | CN1OC2(CCCCC2)n2c(=O)c3ccccc3c(=O)n2C1c1ccccc1 |
|
~%
3-methyl-4-phen... CAS#:52165-40-9 |
| Literature: Heine,H.W.; Heitz,L. Journal of Organic Chemistry, 1974 , vol. 39, # 22 p. 3192 - 3194 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |