Glyburide (potassium salt)
Modify Date: 2025-08-22 01:15:17
Glyburide (potassium salt) structure
|
Common Name | Glyburide (potassium salt) | ||
|---|---|---|---|---|
| CAS Number | 52169-36-5 | Molecular Weight | 533.10200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H28ClKN3O5S+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Glyburide (potassium salt)Glibenclamide (Glyburide) potassium is a potassium salt of Glibenclamide (HY-15206). Glibenclamid potassium exists in anhydrous and hydrate forms, with higher solubility compared to pure Glibenclamide[1]. |
| Name | Glyburide (potassium salt) |
|---|
| Description | Glibenclamide (Glyburide) potassium is a potassium salt of Glibenclamide (HY-15206). Glibenclamid potassium exists in anhydrous and hydrate forms, with higher solubility compared to pure Glibenclamide[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C23H28ClKN3O5S+ |
|---|---|
| Molecular Weight | 533.10200 |
| Exact Mass | 532.10800 |
| PSA | 121.98000 |
| LogP | 5.89520 |
| InChIKey | WUVNANLGKVVVAV-UHFFFAOYSA-N |
| SMILES | COc1ccc(Cl)cc1C(=O)NCCc1ccc(S(=O)(=O)NC(=O)NC2CCCCC2)cc1.[K] |