3-(3-chlorophenyl)-1-(4-methoxyphenyl)prop-2-en-1-one structure
|
Common Name | 3-(3-chlorophenyl)-1-(4-methoxyphenyl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 52182-25-9 | Molecular Weight | 272.72600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(3-chlorophenyl)-1-(4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H13ClO2 |
|---|---|
| Molecular Weight | 272.72600 |
| Exact Mass | 272.06000 |
| PSA | 26.30000 |
| LogP | 4.24470 |
| InChIKey | UNNQBOJITJAFMT-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)C=Cc2cccc(Cl)c2)cc1 |
|
~87%
3-(3-chlorophen... CAS#:52182-25-9 |
| Literature: Popat; Nimavat; Kachhadia; Joshi Journal of the Indian Chemical Society, 2003 , vol. 80, # 7 p. 707 - 708 |
| 2-Propen-1-one,3-(3-chlorophenyl)-1-(4-methoxyphenyl) |
| 3-chloro-4'-methoxychalcone |