5-(3-chlorophenyl)-3-(4-methoxyphenyl)-1,2-oxazole structure
|
Common Name | 5-(3-chlorophenyl)-3-(4-methoxyphenyl)-1,2-oxazole | ||
|---|---|---|---|---|
| CAS Number | 76112-09-9 | Molecular Weight | 285.72500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(3-chlorophenyl)-3-(4-methoxyphenyl)-1,2-oxazole |
|---|
| Molecular Formula | C16H12ClNO2 |
|---|---|
| Molecular Weight | 285.72500 |
| Exact Mass | 285.05600 |
| PSA | 35.26000 |
| LogP | 4.67060 |
| InChIKey | QTCBNQKPTHAABW-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(-c3cccc(Cl)c3)on2)cc1 |
|
~81%
5-(3-chlorophen... CAS#:76112-09-9 |
| Literature: Popat; Nimavat; Kachhadia; Joshi Journal of the Indian Chemical Society, 2003 , vol. 80, # 7 p. 707 - 708 |
|
~%
5-(3-chlorophen... CAS#:76112-09-9 |
| Literature: Fulmer, Tammy D.; Dasher, Lisette P.; Bobb, Bonni L.; Wilson, Jana D.; Sides, Kimberly L.; Beam, Charles F. Journal of Heterocyclic Chemistry, 1980 , vol. 17, p. 799 - 800 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |